CymitQuimica logo

CAS 7491-35-2

:

2,5-dihydroxybenzoic acid - 2-aminoethanol (1:1)

Description:
2,5-Dihydroxybenzoic acid - 2-aminoethanol (1:1), with the CAS number 7491-35-2, is a chemical compound that combines a dihydroxybenzoic acid derivative with an amino alcohol. This substance typically exhibits characteristics associated with both its components: the dihydroxybenzoic acid portion contributes to its acidity and potential for hydrogen bonding, while the aminoethanol component introduces basicity and the ability to form amine-related interactions. The compound is likely to be soluble in polar solvents due to the presence of hydroxyl and amino groups, which can engage in hydrogen bonding. Its structure suggests potential applications in pharmaceuticals, biochemistry, and materials science, particularly in areas requiring chelation or stabilization of metal ions. Additionally, the presence of both acidic and basic functional groups may allow for buffering capabilities in biological systems. Overall, this compound's unique properties stem from the interplay between its acidic and basic functionalities, making it a subject of interest in various chemical and biological contexts.
Formula:C9H13NO5
InChI:InChI=1/C7H6O4.C2H7NO/c8-4-1-2-6(9)5(3-4)7(10)11;3-1-2-4/h1-3,8-9H,(H,10,11);4H,1-3H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.