CAS 74916-44-2
:7-fluoro-1,2,4-benzotriazin-3-amine
Description:
7-Fluoro-1,2,4-benzotriazin-3-amine is a chemical compound characterized by its unique structure, which includes a benzotriazine core with a fluorine substituent at the 7-position and an amino group at the 3-position. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in polar solvents and stability under standard conditions. The presence of the fluorine atom can influence its reactivity and biological activity, often enhancing lipophilicity and altering electronic properties. As a benzotriazine derivative, it may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's CAS number, 74916-44-2, allows for its identification in chemical databases and literature. Safety data sheets and handling guidelines should be consulted for information regarding toxicity and safe usage, as compounds of this nature may pose health risks. Overall, 7-fluoro-1,2,4-benzotriazin-3-amine represents a class of compounds with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C7H5FN4
InChI:InChI=1/C7H5FN4/c8-4-1-2-5-6(3-4)11-12-7(9)10-5/h1-3H,(H2,9,10,12)
SMILES:c1cc2c(cc1F)nnc(=N)[nH]2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.