CAS 749192-64-1

ethyl (3R,4R)-4-phenylpiperidine-3-carboxylate

Description:

Ethyl (3R,4R)-4-phenylpiperidine-3-carboxylate is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The compound features a phenyl group attached to the fourth carbon of the piperidine ring, contributing to its aromatic properties. The presence of the ethyl ester functional group at the carboxylate position enhances its solubility in organic solvents and may influence its biological activity. The specific stereochemistry denoted by (3R,4R) indicates the spatial arrangement of substituents around the chiral centers, which can significantly affect the compound's pharmacological properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in developing therapeutic agents. Its CAS number, 749192-64-1, serves as a unique identifier for regulatory and research purposes. Overall, the structural features and stereochemistry of ethyl (3R,4R)-4-phenylpiperidine-3-carboxylate suggest it may exhibit specific interactions with biological targets, making it a subject of study in drug development.

Formula: C₁₄H₁₉NO₂

InChI: InChI=1/C14H19NO2/c1-2-17-14(16)13-10-15-9-8-12(13)11-6-4-3-5-7-11/h3-7,12-13,15H,2,8-10H2,1H3/t12-,13-/m0/s1

SMILES: CCOC(=O)[C@H]1CNCC[C@H]1c1ccccc1