
CAS 7492-29-7
:Clazolam
Description:
Clazolam, with the CAS number 7492-29-7, is a chemical compound belonging to the benzodiazepine class, which is known for its psychoactive properties. It is characterized by its ability to act as a central nervous system depressant, exhibiting anxiolytic, sedative, and muscle relaxant effects. Clazolam is typically recognized for its structural features, which include a fused benzene and diazepine ring, contributing to its pharmacological activity. The compound is often studied for its potential therapeutic applications, although it may also pose risks of dependence and withdrawal symptoms, similar to other benzodiazepines. Its use is regulated in many countries due to concerns over abuse and safety. Clazolam's solubility, stability, and reactivity can vary depending on environmental conditions, making it important to handle it with care in laboratory settings. As with all psychoactive substances, understanding its pharmacodynamics and pharmacokinetics is crucial for assessing its effects and potential therapeutic benefits.
Formula:C18H17ClN2O
InChI:InChI=1S/C18H17ClN2O/c1-20-16-7-6-13(19)10-15(16)18-14-5-3-2-4-12(14)8-9-21(18)11-17(20)22/h2-7,10,18H,8-9,11H2,1H3
InChI key:InChIKey=YAQKGZXXQNKEET-UHFFFAOYSA-N
SMILES:CN1C=2C(C3C=4C(CCN3CC1=O)=CC=CC4)=CC(Cl)=CC2
Synonyms:- Clazolam
- 2-Chloro-5-methyl-5,6,9,10-tetrahydro(7H)-isoquinolino[2,1-d]benzo[1,4]diazepin-6-one
- Isoquino[2,1-d][1,4]benzodiazepin-6(7H)-one, 2-chloro-5,9,10,14b-tetrahydro-5-methyl-
- 2-Chloro-5,9,10,14b-tetrahydro-5-methylisoquino[2,1-d][1,4]benzodiazepin-6(7H)-one
- Isoquinazepon
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Isoquinazepon-d3
CAS:Controlled ProductFormula:C18D3H14ClN2OColor and Shape:NeatMolecular weight:315.812
