
CAS 7492-39-9
:[[1-(2-Methoxyethoxy)ethoxy]methyl]benzene
Description:
The chemical substance known as [[1-(2-Methoxyethoxy)ethoxy]methyl]benzene, with the CAS number 7492-39-9, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a methoxyethoxyethyl group. This compound typically exhibits properties associated with both aromatic and ether functionalities, such as moderate volatility and solubility in organic solvents. Its molecular structure suggests potential applications in various fields, including as a solvent or intermediate in organic synthesis. The presence of ether linkages may impart specific reactivity patterns, making it useful in reactions involving nucleophilic substitution. Additionally, the methoxy groups can influence the compound's polarity and hydrogen bonding capabilities, affecting its interactions with other substances. Safety data should be consulted for handling and storage, as with any chemical, to ensure proper precautions are taken due to potential health and environmental impacts. Overall, this compound exemplifies the diverse nature of organic chemistry and the importance of functional groups in determining chemical behavior.
Formula:C12H18O3
InChI:InChI=1S/C12H18O3/c1-11(14-9-8-13-2)15-10-12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3
InChI key:InChIKey=CNGTXGHYZBQUQS-UHFFFAOYSA-N
SMILES:C(OC(OCCOC)C)C1=CC=CC=C1
Synonyms:- [[1-(2-Methoxyethoxy)ethoxy]methyl]benzene
- Benzene, [[1-(2-methoxyethoxy)ethoxy]methyl]-
- Acetaldehyde, benzyl 2-methoxyethyl acetal
- Acetaldehyde benzyl β-methoxyethyl acetal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.