
CAS 749219-30-5
:4-Chloro-N-[4-[(difluoromethyl)thio]phenyl]-3-nitrobenzenesulfonamide
Description:
4-Chloro-N-[4-[(difluoromethyl)thio]phenyl]-3-nitrobenzenesulfonamide is a synthetic organic compound characterized by its complex structure, which includes a sulfonamide functional group, a nitro group, and a chloro substituent. This compound features a difluoromethylthio group, contributing to its unique reactivity and potential biological activity. The presence of the sulfonamide moiety suggests potential applications in medicinal chemistry, particularly as a pharmacophore in drug development. The nitro group may enhance the compound's electron-withdrawing properties, influencing its interaction with biological targets. Additionally, the chloro substituent can affect the compound's lipophilicity and solubility, which are critical factors in drug design. The compound's molecular structure indicates it may exhibit specific pharmacological properties, making it of interest in research related to therapeutic agents. Overall, 4-Chloro-N-[4-[(difluoromethyl)thio]phenyl]-3-nitrobenzenesulfonamide represents a class of compounds that may have significant implications in various chemical and biological applications.
Formula:C13H9ClF2N2O4S2
InChI:InChI=1S/C13H9ClF2N2O4S2/c14-11-6-5-10(7-12(11)18(19)20)24(21,22)17-8-1-3-9(4-2-8)23-13(15)16/h1-7,13,17H
InChI key:InChIKey=JHMHFLVLCBYZLM-UHFFFAOYSA-N
SMILES:S(NC1=CC=C(SC(F)F)C=C1)(=O)(=O)C2=CC(N(=O)=O)=C(Cl)C=C2
Synonyms:- 4-Chloro-N-[4-[(difluoromethyl)thio]phenyl]-3-nitrobenzenesulfonamide
- Benzenesulfonamide, 4-chloro-N-[4-[(difluoromethyl)thio]phenyl]-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.