CymitQuimica logo

CAS 749230-16-8

:

1,4-difluoro-2-(methoxymethoxy)benzene

Description:
1,4-Difluoro-2-(methoxymethoxy)benzene is an organic compound characterized by the presence of two fluorine atoms and a methoxymethoxy functional group attached to a benzene ring. The fluorine substituents are located at the 1 and 4 positions of the aromatic ring, which can influence the compound's electronic properties and reactivity. The methoxymethoxy group, which consists of a methoxy (-OCH3) group attached to another methoxy group, enhances the compound's solubility in organic solvents and may affect its interactions in various chemical environments. This compound is likely to exhibit moderate polarity due to the presence of the electronegative fluorine atoms and the ether functionalities. Its unique structure may make it of interest in various applications, including pharmaceuticals, agrochemicals, or materials science, where specific electronic or steric properties are desired. As with many fluorinated compounds, it may also exhibit stability against degradation, making it suitable for certain industrial applications. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated organic compounds.
Formula:C8H8F2O2
InChI:InChI=1/C8H8F2O2/c1-11-5-12-8-4-6(9)2-3-7(8)10/h2-4H,5H2,1H3
InChI key:PVPJQNWLCJWHGU-UHFFFAOYSA-N
SMILES:COCOc1cc(ccc1F)F
Found 4 products.