CAS 749230-37-3
:3,6-difluoro-2-hydroxy-benzoic acid
Description:
3,6-Difluoro-2-hydroxybenzoic acid is an aromatic compound characterized by the presence of two fluorine atoms and a hydroxyl group attached to a benzoic acid structure. The fluorine substituents are located at the 3 and 6 positions of the benzene ring, while the hydroxyl group is positioned at the 2 position, contributing to its acidity and potential for hydrogen bonding. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydroxyl group, while the fluorine atoms can enhance its lipophilicity and influence its reactivity. The presence of both electron-withdrawing (fluorine) and electron-donating (hydroxyl) groups can affect its acidity and overall chemical behavior. Additionally, 3,6-difluoro-2-hydroxybenzoic acid may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to its unique structural features that can interact with biological systems or facilitate chemical reactions.
Formula:C7H4F2O3
InChI:InChI=1/C7H4F2O3/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,10H,(H,11,12)
SMILES:c1cc(c(c(c1F)C(=O)O)O)F
Synonyms:- 3,6-Difluoro-2-hydroxybenzoic acid
- Benzoic acid, 3,6-difluoro-2-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,6-Difluoro-2-hydroxybenzoic acid
CAS:Formula:C7H4F2O3Purity:98%Color and Shape:SolidMolecular weight:174.10173,6-Difluoro-2-hydroxybenzoic acid
CAS:3,6-Difluoro-2-hydroxybenzoic acidFormula:C7H4F2O3Purity:≥95%Color and Shape: faint beige to brown powderMolecular weight:174.10g/mol3,6-Difluoro-2-hydroxybenzoic acid methyl ester
CAS:<p>3,6-Difluoro-2-hydroxybenzoic acid methyl ester is a combination of two substances that are used as deodorants and antiperspirants. They work by blocking the pores in the skin, which prevents perspiration and reduces body odor. 3,6-Difluoro-2-hydroxybenzoic acid methyl ester is not an anti-inflammatory drug.</p>Formula:C7H4F2O3Purity:Min. 95%Molecular weight:174.1 g/mol3,6-Difluoro-2-hydroxybenzoic acid
CAS:Formula:C7H4F2O3Purity:≥95%Color and Shape:SolidMolecular weight:174.103



