CAS 749240-53-7
:7-fluoro-4-methyl-1H-indole-2,3-dione
Description:
7-Fluoro-4-methyl-1H-indole-2,3-dione, identified by its CAS number 749240-53-7, is a synthetic organic compound belonging to the indole family, characterized by its unique bicyclic structure. This compound features a fluorine atom at the 7-position and a methyl group at the 4-position of the indole ring, along with two carbonyl groups at the 2 and 3 positions, contributing to its diketone functionality. The presence of these functional groups imparts notable chemical reactivity, making it a potential candidate for various applications in medicinal chemistry and material science. The fluorine substitution can enhance lipophilicity and biological activity, while the indole core is known for its role in numerous natural products and pharmaceuticals. Additionally, the compound's properties, such as solubility, stability, and reactivity, can be influenced by the electronic effects of the substituents. Overall, 7-fluoro-4-methyl-1H-indole-2,3-dione represents a versatile scaffold for further chemical modifications and investigations in drug development and related fields.
Formula:C9H6FNO2
InChI:InChI=1/C9H6FNO2/c1-4-2-3-5(10)7-6(4)8(12)9(13)11-7/h2-3H,1H3,(H,11,12,13)
SMILES:Cc1ccc(c2c1C(=O)C(=O)N2)F
Synonyms:- 1H-indole-2,3-dione, 7-fluoro-4-methyl-
- 7-Fluoro-4-methyl-1H-indole-2,3-dione
- 4-Fluoro-7-methyl-1H-indole-2,3-dione
- 4-fluoro-7-methyl-1H-indole-2,3-dione
- 1H-Indole-2,3-dione, 4-fluoro-7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.