CAS 749253-12-1

Benzenesulfonamide, 3-chloro-4-ethoxy-

Description:

Benzenesulfonamide, 3-chloro-4-ethoxy- is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring, which is further substituted with a chloro group and an ethoxy group. The chloro substituent typically enhances the compound's reactivity, while the ethoxy group can influence its solubility and overall chemical behavior. This compound is likely to exhibit properties typical of sulfonamides, such as potential antibacterial activity, due to the sulfonamide moiety. Additionally, the presence of the chloro and ethoxy groups can affect its electronic properties and steric hindrance, which may play a role in its biological activity or interactions with other molecules. The compound's molecular structure suggests it may be used in various applications, including pharmaceuticals or agrochemicals, although specific uses would depend on further research into its efficacy and safety. As with many chemical substances, handling should be done with care, considering potential hazards associated with its components.

Formula: C₈H₁₀ClNO₃S

InChI: InChI=1S/C8H10ClNO3S/c1-2-13-8-4-3-6(5-7(8)9)14(10,11)12/h3-5H,2H2,1H3,(H2,10,11,12)

InChI key: InChIKey=WNQOPSHIWNZCGO-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=CC(Cl)=C(OCC)C=C1

Synonyms:

• 3-Chloro-4-ethoxy-benzenesulfonamide
• Benzenesulfonamide, 3-chloro-4-ethoxy-
• 3-Chloro-4-ethoxybenzene-1-sulfonamide