CAS 74928-54-4

N-(3,5-dinitrobenzoyl)-dl-leucine

Description:

N-(3,5-dinitrobenzoyl)-dl-leucine is a chemical compound characterized by its structure, which includes a leucine amino acid moiety modified with a 3,5-dinitrobenzoyl group. This modification enhances its reactivity and solubility properties. The presence of the dinitrobenzoyl group introduces significant electron-withdrawing characteristics, which can influence the compound's behavior in various chemical reactions, particularly in nucleophilic substitutions. The compound is typically used in biochemical applications, including studies related to protein interactions and enzyme activity, due to its ability to form stable conjugates with amino acids and proteins. It is important to handle this compound with care, as the nitro groups can impart explosive properties under certain conditions. Additionally, N-(3,5-dinitrobenzoyl)-dl-leucine may exhibit specific optical activity due to the presence of the chiral leucine component, which can be relevant in stereochemical studies. Overall, this compound serves as a valuable tool in chemical and biological research, particularly in the fields of medicinal chemistry and biochemistry.

Formula: C₁₃H₁₅N₃O₇

InChI: InChI=1/C13H15N3O7/c1-7(2)3-11(13(18)19)14-12(17)8-4-9(15(20)21)6-10(5-8)16(22)23/h4-7,11H,3H2,1-2H3,(H,14,17)(H,18,19)

SMILES: CC(C)CC(C(=O)O)N=C(c1cc(cc(c1)N(=O)=O)N(=O)=O)O

Synonyms:

• N-(3,5-dinitrobenzoyl)-L-leucine
• N-(3,5-dinitrobenzoyl)leucine

N-(3,5-Dinitrobenzoyl)-DL-leucine

CAS: 74928-54-4

Molecular weight: 325.27

Ref: 7W-GM5878