CAS 74938-11-7
:7-Hydroxy-N,N-dipropyl-2-aminotetralin
Description:
7-Hydroxy-N,N-dipropyl-2-aminotetralin, identified by its CAS number 74938-11-7, is a chemical compound that belongs to the class of aminotetralins, which are derivatives of tetralin. This compound features a hydroxyl group (-OH) at the 7-position and two propyl groups attached to the nitrogen atom, contributing to its unique properties. It is known for its potential activity as a selective agonist for certain serotonin receptors, particularly the 5-HT1A receptor, which may influence its pharmacological effects. The presence of the hydroxyl group enhances its solubility and reactivity, while the dipropyl substitution can affect its lipophilicity and biological activity. As with many compounds in this class, it may be of interest in research related to neuropharmacology and the development of therapeutic agents targeting mood disorders or other neurological conditions. However, detailed studies on its safety, efficacy, and specific applications are necessary to fully understand its potential uses in medicinal chemistry.
Formula:C16H25NO
InChI:InChI=1S/C16H25NO/c1-3-9-17(10-4-2)15-7-5-13-6-8-16(18)12-14(13)11-15/h6,8,12,15,18H,3-5,7,9-11H2,1-2H3
InChI key:InChIKey=BLYMJBIZMIGWFK-UHFFFAOYSA-N
SMILES:N(CCC)(CCC)C1CC=2C(CC1)=CC=C(O)C2
Synonyms:- (?à)-7-OH-DPAT
- 2-(Di-n-propylamino)-7-hydroxytetralin
- 7-(Dipropylamino)-5,6,7,8-tetrahydro-2-naphthalenol
- 7-Hydroxy-2-(di-n-propylamino)tetralin
- 7-Hydroxy-N,N-dipropyl-2-aminotetralin
- 7-Oh-Dpat
- Dp-7-At
- N,N-Dipropyl-7-hydroxy-2-aminotetralin
- 2-Naphthalenol, 7-(dipropylamino)-5,6,7,8-tetrahydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
7-Hydroxy-DPAT
CAS:Controlled Product7-Hydroxy-DPAT is a neuroprotective compound that acts as a selective agonist for serotonin receptors. It has been shown to have controlled properties, making it suitable for use in various products. 7-Hydroxy-DPAT can be used as an electrode in medical devices or as a solute in fungicidal compositions. Additionally, it has been studied for its potential therapeutic effects in conditions such as dimethyl fumarate and laquinimod sodium. The compound exhibits strong binding affinity to calmodulin, which plays a crucial role in regulating calcium-dependent signaling pathways. Furthermore, 7-Hydroxy-DPAT has shown interactions with other compounds like caffeine and pregnanediol-3-glucuronide, suggesting possible synergistic effects. Overall, this versatile compound offers promising applications in the field of neuroprotection and beyond.Formula:C16H26BrNOPurity:Min. 95%Molecular weight:328.29 g/mol
