CAS 7494-77-1

[4-(dimethylamino)phenyl](phenyl)methanol

Description:

[4-(Dimethylamino)phenyl](phenyl)methanol, with the CAS number 7494-77-1, is an organic compound characterized by its structure, which features a phenolic group attached to a dimethylamino-substituted phenyl moiety. This compound typically exhibits properties associated with both aromatic amines and alcohols, including potential solubility in organic solvents and moderate polarity due to the hydroxyl (-OH) group. The presence of the dimethylamino group can impart basicity and influence the compound's reactivity, particularly in electrophilic aromatic substitution reactions. Additionally, the compound may display colorimetric properties, making it useful in various applications, including dyes and pigments. Its molecular structure suggests potential interactions with biological systems, which could be relevant in pharmacological contexts. However, safety and handling precautions should be observed, as compounds with amine functionalities can sometimes exhibit toxicity or irritant properties. Overall, [4-(dimethylamino)phenyl](phenyl)methanol is a versatile compound with applications in both industrial and research settings.

Formula: C₁₅H₁₇NO

InChI: InChI=1/C15H17NO/c1-16(2)14-10-8-13(9-11-14)15(17)12-6-4-3-5-7-12/h3-11,15,17H,1-2H3

SMILES: CN(C)c1ccc(cc1)C(c1ccccc1)O

Synonyms:

• Benzenemethanol, 4-(dimethylamino)-alpha-phenyl-
• [4-(Dimethylamino)phenyl](phenyl)methanol

[4-(Dimethylamino)phenyl](phenyl)methanol

CAS: 7494-77-1

[4-(Dimethylamino)phenyl](phenyl)methanol is an aromatic compound that can be synthesized from benzotriazole and a grignard reagent. It has been used as a reagent in the synthesis of hydroxybenzaldehydes, pyridine, resorcinol, naphthol, or aryl groups. The condensation reaction between 4-dimethylaminophenyl methyl ether and phenylmagnesium bromide is catalyzed by pyridine and produces the desired product. This compound is also used in the synthesis of benzotriazolyl.

Formula: C₁₅H₁₇NO

Purity: Min. 95%

Molecular weight: 227.3 g/mol

Ref: 3D-HAA49477