CAS 7495-77-4
:4-Isopropoxyphenol
Description:
4-Isopropoxyphenol, with the CAS number 7495-77-4, is an organic compound characterized by its phenolic structure, where an isopropoxy group is attached to the para position of the phenol ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate solubility in organic solvents and limited solubility in water, which is common for many phenolic compounds. 4-Isopropoxyphenol exhibits antioxidant properties, making it useful in various applications, including as a stabilizer in plastics and as an intermediate in organic synthesis. Its chemical behavior is influenced by the presence of the hydroxyl group, which can participate in hydrogen bonding and influence reactivity. Safety data indicates that, like many phenolic compounds, it should be handled with care due to potential irritant effects on skin and mucous membranes. Overall, 4-Isopropoxyphenol is a versatile compound with applications in both industrial and research settings.
Formula:C9H12O2
InChI:InChI=1S/C9H12O2/c1-7(2)11-9-5-3-8(10)4-6-9/h3-7,10H,1-2H3
InChI key:InChIKey=QEYQMWSESURNPP-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=CC=C(O)C=C1
Synonyms:- 4-(1-Methylethoxy)phenol
- 4-(Propan-2-Yloxy)Phenol
- 4-Isopropoxyphenol
- Ai3-19942
- Isopropyl p-hydroxyphenyl ether
- Nsc 407767
- Phenol, 4-(1-methylethoxy)-
- Phenol, p-isopropoxy-
- p-Isopropoxyphenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Phenol, 4-(1-methylethoxy)-
CAS:Formula:C9H12O2Purity:97%Color and Shape:LiquidMolecular weight:152.19044-Isopropoxyphenol
CAS:4-IsopropoxyphenolFormula:C9H12O2Purity:95%Color and Shape: brown liquidMolecular weight:152.19g/mol4-Isopropoxyphenol
CAS:4-Isopropoxyphenol is a reactive molecule that can undergo nucleophilic attack. It is an intermediate in the reaction mechanism of phenolic antioxidants, such as salicylaldoxime and mequinol. 4-Isopropoxyphenol is synthesized by the condensation of anilines with phenols, followed by acid hydrolysis. The nature of 4-isopropoxyphenol is primarily nucleophilic, making it a potential candidate for optimization or predictive modelling.
Formula:C9H12O2Purity:Min. 95%Molecular weight:152.19 g/mol



