CAS 74959-65-2

2-(4-chlorobenzylidene)-N-phenylhydrazinecarbothioamide

Description:

2-(4-Chlorobenzylidene)-N-phenylhydrazinecarbothioamide, with the CAS number 74959-65-2, is an organic compound characterized by its hydrazinecarbothioamide structure, which features a hydrazine moiety linked to a phenyl group and a 4-chlorobenzylidene substituent. This compound typically exhibits properties associated with thioamide derivatives, including potential biological activity and reactivity due to the presence of the thioamide functional group. It may display moderate solubility in organic solvents, depending on the specific conditions, and can participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. The presence of the chlorobenzylidene group may enhance its reactivity and influence its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in the development of pharmaceuticals or agrochemicals, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₄H₁₂ClN₃S

InChI: InChI=1/C14H12ClN3S/c15-12-8-6-11(7-9-12)10-16-18-14(19)17-13-4-2-1-3-5-13/h1-10H,(H2,17,18,19)

SMILES: c1ccc(cc1)N=C(NN=Cc1ccc(cc1)Cl)S

2-[(4-Chlorophenyl)methylene]-N-phenylhydrazinecarbothioamide

Controlled Product

CAS: 74959-65-2

Formula: C₁₄H₁₂ClN₃S

Color and Shape: Neat

Molecular weight: 289.78

Ref: TR-C327130

2-[(4-Chlorophenyl)methylene]-N-phenylhydrazinecarbothioamide

CAS: 74959-65-2

2-[(4-Chlorophenyl)methylene]-N-phenylhydrazinecarbothioamide is a potent Chinese medicinal compound that has been shown to be an effective inhibitor of cancer cell growth. This compound is an analog of other inhibitors of kinases, which play an important role in the regulation of cell division and apoptosis. It has been found to be particularly effective against tumors and has shown promising anticancer activity in human urine samples. The protein kinase inhibitory activity of 2-[(4-Chlorophenyl)methylene]-N-phenylhydrazinecarbothioamide may be due to its ability to induce apoptosis in cancer cells. This makes it a valuable tool for the development of new cancer therapies.

Formula: C₁₄H₁₂ClN₃S

Purity: Min. 95%

Molecular weight: 289.8 g/mol

Ref: 3D-ZCA95965