CAS 7496-68-6

acenaphtho[1,2-d][1,3]thiazol-8-amine

Description:

Acenaphtho[1,2-d][1,3]thiazol-8-amine is an organic compound characterized by its fused acenaphthene and thiazole structures, which contribute to its unique chemical properties. This compound typically exhibits a solid state at room temperature and is known for its potential applications in organic electronics, pharmaceuticals, and as a building block in organic synthesis. The presence of the amino group (-NH2) at the 8-position of the thiazole ring enhances its reactivity, making it a useful intermediate in various chemical reactions, including coupling reactions and as a ligand in coordination chemistry. Additionally, the thiazole moiety can impart biological activity, making this compound of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which may lead to various pharmacological effects. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₃H₈N₂S

InChI: InChI=1/C13H8N2S/c14-13-15-11-8-5-1-3-7-4-2-6-9(10(7)8)12(11)16-13/h1-6H,(H2,14,15)

SMILES: c1cc2cccc3c2c(c1)c1c3sc(=N)[nH]1

Synonyms:

• 7-Thia-9-aza-cyclopenta[a]acenaphthylen-8-ylamine
• Acenaphtho[1,2-D]Thiazol-8-Amine
• Acenaphtho[1,2-d][1,3]thiazol-8-amine

Acenaphtho[1,2-d][1,3]thiazol-8-amine

CAS: 7496-68-6

Purity: 95.0%

Molecular weight: 224.28

Ref: 10-F495460