CAS 7496-73-3

2-(4-chlorophenyl)indolizine

Description:

2-(4-Chlorophenyl)indolizine, with the CAS number 7496-73-3, is an organic compound characterized by its indolizine core structure, which is a five-membered heterocyclic ring containing nitrogen. The presence of a 4-chlorophenyl group at the 2-position of the indolizine ring contributes to its unique chemical properties, including potential reactivity and biological activity. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry and material science. The chlorophenyl substituent can influence the compound's electronic properties, potentially affecting its reactivity and interactions with biological targets. Additionally, compounds like 2-(4-chlorophenyl)indolizine may exhibit fluorescence, making them useful in various applications, including as dyes or in the development of fluorescent probes. Overall, this compound's characteristics make it a subject of interest for further research in synthetic and applied chemistry.

Formula: C₁₄H₁₀ClN

InChI: InChI=1/C14H10ClN/c15-13-6-4-11(5-7-13)12-9-14-3-1-2-8-16(14)10-12/h1-10H

SMILES: c1ccn2cc(cc2c1)c1ccc(cc1)Cl

Synonyms:

• 2-(4-Chlorphenyl)indolizin
• Indolizine, 2-(4-chlorophenyl)-
• 2-(4-Chlorophenyl)indolizine

2-(4-Chlorophenyl)indolizine

Controlled Product

CAS: 7496-73-3

Formula: C₁₄H₁₀ClN

Color and Shape: Neat

Molecular weight: 307.324

Ref: TR-C377760