
CAS 7496-74-4
:2-(3-Nitrophenyl)indolizine
Description:
2-(3-Nitrophenyl)indolizine is an organic compound characterized by its indolizine core structure, which is a five-membered heterocyclic ring containing nitrogen. The presence of a nitrophenyl group at the 2-position of the indolizine ring introduces significant electronic and steric effects, influencing its reactivity and properties. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also affect its solubility in various solvents. It may display interesting photophysical properties, making it a candidate for applications in organic electronics or as a dye. The nitro group can participate in various chemical reactions, including reduction and nucleophilic substitution, making this compound versatile in synthetic organic chemistry. Additionally, the presence of the indolizine moiety may impart biological activity, warranting further investigation into its potential pharmacological applications. Overall, 2-(3-Nitrophenyl)indolizine is a compound of interest due to its unique structural features and potential utility in various chemical and biological contexts.
Formula:C14H10N2O2
InChI:InChI=1S/C14H10N2O2/c17-16(18)14-6-3-4-11(8-14)12-9-13-5-1-2-7-15(13)10-12/h1-10H
InChI key:InChIKey=WDNGCEBMFLHBOX-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C=2C=C3N(C2)C=CC=C3)C=CC1
Synonyms:- Indolizine, 2-(3-nitrophenyl)-
- 2-(3-Nitrophenyl)indolizine
- NSC 405319
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.