CAS 7496-82-4
:2-(4-methoxyphenyl)indolizine
Description:
2-(4-Methoxyphenyl)indolizine, with the CAS number 7496-82-4, is an organic compound characterized by its indolizine core structure, which is a bicyclic compound containing a five-membered nitrogen-containing ring fused to a six-membered ring. The presence of the 4-methoxyphenyl group enhances its chemical properties, contributing to its potential applications in various fields, including pharmaceuticals and materials science. This compound typically exhibits moderate solubility in organic solvents and may show limited solubility in water due to its hydrophobic characteristics. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, 2-(4-methoxyphenyl)indolizine may display interesting optical properties, which can be useful in the development of organic light-emitting diodes (OLEDs) or other optoelectronic devices. As with many organic compounds, its reactivity can be influenced by the substituents on the indolizine ring, which can affect its stability and interaction with other chemical species.
Formula:C15H13NO
InChI:InChI=1/C15H13NO/c1-17-15-7-5-12(6-8-15)13-10-14-4-2-3-9-16(14)11-13/h2-11H,1H3
Synonyms:- 2-(4-Methoxyphenyl)indolizin
- indolizine, 2-(4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.