CAS 74960-58-0

2-ethyl-3-methylquinoline-4-carboxylate

Description:

2-Ethyl-3-methylquinoline-4-carboxylate is an organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a nitrogen atom. This compound features a carboxylate functional group, which contributes to its reactivity and solubility properties. Typically, it appears as a yellow to brown solid or liquid, depending on its purity and specific conditions. The presence of ethyl and methyl substituents on the quinoline ring influences its physical and chemical properties, such as boiling point, melting point, and solubility in various solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Additionally, its unique structure allows for potential applications in organic synthesis and materials science. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, 2-ethyl-3-methylquinoline-4-carboxylate is a versatile compound with potential applications across various fields of chemistry.

Formula: C₁₃H₁₂NO₂

InChI: InChI=1/C13H13NO2/c1-3-10-8(2)12(13(15)16)9-6-4-5-7-11(9)14-10/h4-7H,3H2,1-2H3,(H,15,16)/p-1

SMILES: CCc1c(C)c(c2ccccc2n1)C(=O)[O-]