CAS 7497-89-4
:Methyl 3-Phenoxy Propanoic Acid Ester
Description:
Methyl 3-phenoxy propanoic acid ester, with the CAS number 7497-89-4, is an organic compound characterized by its ester functional group, which is formed from the reaction of a carboxylic acid and an alcohol. This compound typically exhibits a pleasant aromatic odor due to the presence of the phenoxy group, which contributes to its chemical stability and solubility in organic solvents. It is often used in various applications, including as an intermediate in organic synthesis and potentially in the formulation of agrochemicals or fragrances. The presence of the propanoic acid moiety suggests that it may have moderate polarity, allowing it to interact with both hydrophilic and lipophilic environments. Additionally, the compound's structure may impart specific biological activities, making it of interest in pharmaceutical and agricultural research. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.
Formula:C10H12O3
InChI:InChI=1/C10H12O3/c1-12-10(11)7-8-13-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3
SMILES:COC(=O)CCOc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
