CAS 74971-63-4

N-[2-Chloro-4-(trifluoromethyl)phenyl]-L-valine

Description:

N-[2-Chloro-4-(trifluoromethyl)phenyl]-L-valine, with the CAS number 74971-63-4, is an organic compound that features a valine amino acid structure modified by the presence of a 2-chloro-4-(trifluoromethyl)phenyl group. This compound is characterized by its unique combination of functional groups, which contribute to its chemical reactivity and potential biological activity. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's interaction with biological targets. Additionally, the chlorine atom introduces electronegativity, which may affect the compound's overall polarity and solubility in various solvents. N-[2-Chloro-4-(trifluoromethyl)phenyl]-L-valine may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₂H₁₃ClF₃NO₂

InChI: InChI=1S/C12H13ClF3NO2/c1-6(2)10(11(18)19)17-9-4-3-7(5-8(9)13)12(14,15)16/h3-6,10,17H,1-2H3,(H,18,19)/t10-/m0/s1

InChI key: InChIKey=YKSHSSFDOHACTC-JTQLQIEISA-N

SMILES: N([C@@H]([C@H](C)C)C(O)=O)C1=C(Cl)C=C(C(F)(F)F)C=C1

Synonyms:

• N-[2-Chloro-4-(trifluoromethyl)phenyl]-L-valine
• (2S)-2-[[2-Chloro-4-(trifluoromethyl)phenyl]amino]-3-methylbutanoic acid
• L-Valine, N-[2-chloro-4-(trifluoromethyl)phenyl]-