CymitQuimica logo

CAS 74974-15-5

:

N,N′-(1S)-[1,1′-Binaphthalene]-2,2′-diylbis[P,P-diphenylphosphinous amide]

Description:
N,N′-(1S)-[1,1′-Binaphthalene]-2,2′-diylbis[P,P-diphenylphosphinous amide], with CAS number 74974-15-5, is a chiral organophosphorus compound notable for its application in asymmetric synthesis and catalysis. This compound features a binaphthalene backbone, which contributes to its stereochemical properties, allowing for selective interactions in chemical reactions. The presence of diphenylphosphinous amide groups enhances its reactivity and solubility in organic solvents, making it suitable for various catalytic processes. Its unique structure provides a platform for the development of chiral ligands in transition metal catalysis, particularly in reactions that require high enantioselectivity. The compound is typically characterized by its molecular weight, melting point, and spectral data, including NMR and IR spectroscopy, which confirm its structural integrity and functional groups. As with many organophosphorus compounds, safety precautions should be observed due to potential toxicity, and it is essential to handle it in a controlled laboratory environment.
Formula:C44H34N2P2
InChI:InChI=1S/C44H34N2P2/c1-5-19-35(20-6-1)47(36-21-7-2-8-22-36)45-41-31-29-33-17-13-15-27-39(33)43(41)44-40-28-16-14-18-34(40)30-32-42(44)46-48(37-23-9-3-10-24-37)38-25-11-4-12-26-38/h1-32,45-46H
InChI key:InChIKey=NRWZSRQDRSYPNW-UHFFFAOYSA-N
SMILES:N(P(C1=CC=CC=C1)C2=CC=CC=C2)C3=C(C4=C(C=C3)C=CC=C4)C=5C6=C(C=CC5NP(C7=CC=CC=C7)C8=CC=CC=C8)C=CC=C6
Synonyms:
  • Phosphinous amide, N,N′-[1,1′-binaphthalene]-2,2′-diylbis[P,P-diphenyl-, (S)-
  • Phosphinous amide, N,N′-(1S)-[1,1′-binaphthalene]-2,2′-diylbis[P,P-diphenyl-
  • N,N′-(1S)-[1,1′-Binaphthalene]-2,2′-diylbis[P,P-diphenylphosphinous amide]
Found 2 products.