CAS 74975-25-0
:4-benzoylpyridine-3-carboxylic acid
Description:
4-Benzoylpyridine-3-carboxylic acid is an organic compound characterized by its pyridine ring, which is substituted at the 4-position with a benzoyl group and at the 3-position with a carboxylic acid group. This compound typically appears as a solid and is soluble in polar organic solvents. Its molecular structure contributes to its potential applications in pharmaceuticals and organic synthesis, particularly as an intermediate in the preparation of various biologically active compounds. The presence of both the carboxylic acid and the benzoyl group allows for diverse reactivity, including potential participation in acylation and condensation reactions. Additionally, the compound may exhibit interesting properties such as antimicrobial or anti-inflammatory activities, which are common in pyridine derivatives. Its CAS number, 74975-25-0, facilitates its identification in chemical databases and regulatory frameworks. As with many organic compounds, safety data should be consulted to ensure proper handling and usage in laboratory settings.
Formula:C13H9NO3
InChI:InChI=1/C13H9NO3/c15-12(9-4-2-1-3-5-9)10-6-7-14-8-11(10)13(16)17/h1-8H,(H,16,17)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.