CAS 74976-31-1

6-chloro-1H-pyrrolo[3,2-c]pyridine

Description:

6-Chloro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 6-position of the pyrrolo ring enhances its reactivity and can influence its biological activity. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. Its structure allows for potential interactions with biological targets, which has led to interest in its pharmacological properties. The compound may also participate in electrophilic substitution reactions due to the electron-withdrawing nature of the chlorine substituent. Additionally, its molecular framework can serve as a scaffold for the development of novel therapeutic agents. As with many heterocycles, the stability and reactivity of 6-chloro-1H-pyrrolo[3,2-c]pyridine can be influenced by the presence of functional groups and the overall electronic environment of the molecule.

Formula: C₇H₅ClN₂

InChI: InChI=1/C7H5ClN2/c8-7-3-6-5(4-10-7)1-2-9-6/h1-4,9H

SMILES: c1c[nH]c2cc(Cl)ncc12

Synonyms:

• 1H-pyrrolo[3,2-c]pyridine, 6-chloro-
• 6-Choro-5-azaindole

6-Chloro-1H-pyrrolo[3,2-c]pyridine

CAS: 74976-31-1

Formula: C₇H₅ClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 152.5810

Ref: IN-DA0036N2

6-Chloro-5-azaindole

CAS: 74976-31-1

6-Chloro-5-azaindole

Formula: C₇H₅ClN₂

Purity: 97%

Color and Shape: beige solid

Molecular weight: 152.58g/mol

Ref: 54-OR301258

6-Chloro-5-azaindole

CAS: 74976-31-1

Formula: C₇H₅ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 152.58

Ref: 10-F078039