CAS 7498-54-6
:3-tert-butylbenzoic acid
Description:
3-tert-Butylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid moiety with a tert-butyl group attached to the meta position of the benzene ring. Its molecular formula is C12H16O2, indicating that it contains 12 carbon atoms, 16 hydrogen atoms, and 2 oxygen atoms. This compound typically appears as a white to off-white crystalline solid and is known for its relatively low solubility in water, while being more soluble in organic solvents. The presence of the bulky tert-butyl group influences its physical and chemical properties, including its melting point and boiling point, which are generally higher than those of simpler benzoic acids. 3-tert-Butylbenzoic acid can participate in various chemical reactions typical of carboxylic acids, such as esterification and acid-base reactions. It is used in organic synthesis and may serve as an intermediate in the production of other chemical compounds. Additionally, its unique structure may impart specific reactivity and stability characteristics relevant in various applications.
Formula:C11H14O2
InChI:InChI=1/C11H14O2/c1-11(2,3)9-6-4-5-8(7-9)10(12)13/h4-7H,1-3H3,(H,12,13)
SMILES:CC(C)(C)c1cccc(c1)C(=O)O
Synonyms:- Benzoic acid, 3-(1,1-dimethylethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(tert-Butyl)benzoic acid
CAS:Formula:C11H14O2Purity:97%Color and Shape:SolidMolecular weight:178.22773-(tert-Butyl)benzoic acid
CAS:3-(tert-Butyl)benzoic acidFormula:C11H14O2Purity:98%Color and Shape: yellow powderMolecular weight:178.23g/mol3-tert-Butylbenzoic acid
CAS:3-tert-Butylbenzoic acid is a heat-resistant organic compound that has been used in the production of polymers and plastics. 3-tert-Butylbenzoic acid can be used as a nucleation agent for crystallization, or as an enhancer for crystallization. In this application, 3-tert-butylbenzoic acid is used to increase the number of crystals formed and to make them larger. The processability of 3-tert-butylbenzoic acid is also enhanced with the addition of 3-tert-butylbenzoic acid. This substance can be measured by calorimetry, which measures the enthalpy change associated with its melting point. The melting point of 3-tert-butylbenzoic acid is between 100°C and 140°C.
Formula:C11H14O2Purity:Min. 95%Molecular weight:178.23 g/mol



