CAS 7498-66-0
:(3-chlorophenyl)(4-chlorophenyl)methanone
Description:
(3-chlorophenyl)(4-chlorophenyl)methanone, also known as benzophenone-3 or by its CAS number 7498-66-0, is an organic compound characterized by the presence of two chlorophenyl groups attached to a central carbonyl (C=O) functional group. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the presence of the phenyl rings. The chlorinated phenyl groups contribute to its chemical reactivity and influence its physical properties, such as solubility and melting point. It is often utilized in various applications, including as a UV filter in sunscreens and cosmetics, as well as in the synthesis of other organic compounds. The presence of chlorine atoms enhances its stability and can affect its biological activity. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential environmental and health impacts. Overall, (3-chlorophenyl)(4-chlorophenyl)methanone is a significant compound in both industrial and research contexts.
Formula:C13H8Cl2O
InChI:InChI=1/C13H8Cl2O/c14-11-6-4-9(5-7-11)13(16)10-2-1-3-12(15)8-10/h1-8H
SMILES:c1cc(cc(c1)Cl)C(=O)c1ccc(cc1)Cl
Synonyms:- Benzophenone, 3,4'-dichloro-
- Methanone, (3-chlorophenyl)(4-chlorophenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(3-Chlorophenyl)(4-chlorophenyl)methanone
CAS:<p>Chlorobenzene is an organic solvent with a sweet odor and low toxicity. It is a colorless liquid that dissolves in water to give solutions of variable viscosity. Chlorobenzene is obtained by the reaction of benzene with chlorine gas at 400°C or by the action of sodium carbonate on methylbenzene. Chlorobenzene can be polymerized to produce polychlorobiphenyls, which are used as lubricants and plasticizers. The chemical formula for chlorobenzene is C6H5Cl. The chemical properties of chlorobenzene are similar to those of benzene, with one exception: it has a lower boiling point than benzene (83°C).</p>Formula:C13H8OCl2Purity:Min. 95%Color and Shape:PowderMolecular weight:251.1 g/mol
