CymitQuimica logo

CAS 749875-03-4

:

3-Chloro-4-iodo-2-(trifluoromethyl)pyridine

Description:
3-Chloro-4-iodo-2-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chlorine atom at the 3-position and an iodine atom at the 4-position of the pyridine ring, contributing to its reactivity and potential applications in various chemical reactions. Additionally, the presence of a trifluoromethyl group at the 2-position enhances its lipophilicity and can influence its biological activity. The molecular structure of this compound suggests it may exhibit interesting properties such as increased stability and unique interactions with biological targets, making it of interest in medicinal chemistry and agrochemical research. Its CAS number, 749875-03-4, allows for easy identification and retrieval of information in chemical databases. Overall, this compound's unique combination of halogen substituents and a trifluoromethyl group positions it as a valuable intermediate in the synthesis of more complex molecules.
Formula:C6H2ClF3IN
InChI:InChI=1S/C6H2ClF3IN/c7-4-3(11)1-2-12-5(4)6(8,9)10/h1-2H
InChI key:InChIKey=PFYURLXUWVBSRO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Cl)C(I)=CC=N1
Synonyms:
  • 3-Chloro-4-iodo-2-(trifluoromethyl)pyridine
  • Pyridine, 3-chloro-4-iodo-2-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.