
CAS 749875-04-5
:3-Chloro-5-iodo-2-(trifluoromethyl)pyridine
Description:
3-Chloro-5-iodo-2-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a chlorine atom at the 3-position, an iodine atom at the 5-position, and a trifluoromethyl group at the 2-position. This compound features a pyridine structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and potentially its reactivity in various chemical reactions. The chlorine and iodine substituents can also affect the compound's electronic properties, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the presence of halogens may impart unique characteristics such as increased stability and altered solubility in different solvents. Overall, 3-Chloro-5-iodo-2-(trifluoromethyl)pyridine is a valuable compound in research and industrial applications due to its distinctive structural features and reactivity.
Formula:C6H2ClF3IN
InChI:InChI=1S/C6H2ClF3IN/c7-4-1-3(11)2-12-5(4)6(8,9)10/h1-2H
InChI key:InChIKey=BKXZMTAJZBUIAB-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Cl)C=C(I)C=N1
Synonyms:- 3-Chloro-5-iodo-2-(trifluoromethyl)pyridine
- Pyridine, 3-chloro-5-iodo-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.