CAS 749875-11-4

2-Bromo-6-(trifluoromethyl)-4-pyridinecarboxylic acid

Description:

2-Bromo-6-(trifluoromethyl)-4-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 6 positions with a bromine atom and a trifluoromethyl group, respectively. The presence of the carboxylic acid functional group at the 4-position contributes to its acidic properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. Its trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The bromine atom can serve as a site for further chemical modifications, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit interesting pharmacological properties, potentially making it relevant in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2-Bromo-6-(trifluoromethyl)-4-pyridinecarboxylic acid is a versatile compound with applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₇H₃BrF₃NO₂

InChI: InChI=1S/C7H3BrF3NO2/c8-5-2-3(6(13)14)1-4(12-5)7(9,10)11/h1-2H,(H,13,14)

InChI key: InChIKey=XCJIWWDGFHDIBG-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(C(O)=O)=CC(Br)=N1

Synonyms:

• 4-Pyridinecarboxylic acid, 2-bromo-6-(trifluoromethyl)-
• 2-Bromo-6-(trifluoromethyl)isonicotinic acid
• 2-Bromo-6-(trifluoromethyl)-4-pyridinecarboxylic acid