CAS 7499-06-1
:5-Chloro-2-methylbenzoic acid
Description:
5-Chloro-2-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a chlorine atom and a methyl group on a benzoic acid framework. Its molecular structure features a benzene ring substituted at the 5-position with a chlorine atom and at the 2-position with a methyl group, contributing to its unique chemical properties. This compound typically appears as a white to off-white solid and is soluble in organic solvents while exhibiting limited solubility in water. It is known for its applications in organic synthesis, particularly as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the chlorine atom enhances its reactivity, making it a useful building block in various chemical reactions, including electrophilic aromatic substitution. Additionally, 5-Chloro-2-methylbenzoic acid can exhibit acidic properties due to the carboxylic acid functional group, allowing it to participate in acid-base reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C8H7ClO2
InChI:InChI=1S/C8H7ClO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=CSAPESWNZDOAFU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C=CC(Cl)=C1
Synonyms:- 2-Methyl-5-Chloro Benzoic Acid
- 2-Methyl-5-Chlorobenzoic acid
- 3-Chloro-6-methylbenzoic acid
- 5-Chloro-2-methylbenzoic
- 5-Chloro-O-Toluic acid
- Benzoic acid, 5-chloro-2-methyl-
- NSC 407520
- Rarechem Al Bo 0471
- o-Toluic acid, 5-chloro-
- 5-Chloro-2-methylbenzoic acid
- 4-(CHLOROMETHYL)BENZOIC ACID 99+%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Chloro-2-methylbenzoic Acid
CAS:Formula:C8H7ClO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:170.595-Chloro-2-methylbenzoic acid
CAS:Formula:C8H7ClO2Purity:97%Color and Shape:SolidMolecular weight:170.59305-Chloro-2-methylbenzoic acid
CAS:5-Chloro-2-methylbenzoic acidPurity:98%Color and Shape:PowderMolecular weight:170.59g/mol5-Chloro-2-methylbenzoic acid
CAS:5-Chloro-2-methylbenzoic acid (CAS No. 7499-06-1) is a fine chemical that is used as a versatile building block for the production of various organic and inorganic compounds. This compound is also used as an intermediate in the synthesis of pharmaceuticals and other organic chemicals, such as polymers and pigments. 5-Chloro-2-methylbenzoic acid has been shown to have high reactivity with many types of functional groups, making it a valuable research chemical. This compound can be used to synthesize complex compounds with a variety of applications, such as pharmaceuticals, dyes, and pesticides.Formula:C8H7ClO2Purity:Min. 95%Color and Shape:PowderMolecular weight:170.59 g/mol5-Chloro-2-methylbenzoic acid
CAS:Formula:C8H7ClO2Purity:97%Color and Shape:Solid, PowderMolecular weight:170.59




