CAS 7499-08-3
:3-Chloro-2-methylbenzoic acid
Description:
3-Chloro-2-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a chlorine atom and a methyl group on a benzoic acid framework. The chlorine atom is located at the meta position relative to the carboxylic acid group, while the methyl group is positioned at the ortho position. This compound typically appears as a white to off-white crystalline solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. Its molecular structure contributes to its unique chemical properties, including its reactivity in electrophilic substitution reactions and its potential use as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of both the chlorine and methyl substituents influences its acidity and steric properties, making it a valuable compound in organic synthesis. Additionally, 3-chloro-2-methylbenzoic acid may exhibit biological activity, which can be explored in various research applications. Proper handling and safety measures should be observed due to its chemical nature.
Formula:C8H7ClO2
InChI:InChI=1/C8H7ClO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=HXGHMCLCSPQMOR-UHFFFAOYSA-N
SMILES:Cc1c(cccc1Cl)C(=O)O
Synonyms:- 2-Methyl -3-Chlorobenzoic acid
- 3-Chloro-o-toluic acid
- Benzoic acid, 3-chloro-2-methyl-
- NSC 407522
- o-Toluic acid, 3-chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Chloro-2-methylbenzoic Acid
CAS:Formula:C8H7ClO2Purity:>97.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:170.593-Chloro-2-methylbenzoic acid
CAS:Formula:C8H7ClO2Purity:97%Color and Shape:SolidMolecular weight:170.59303-Chloro-2-methylbenzoic acid
CAS:3-Chloro-2-methylbenzoic acidFormula:C8H7ClO2Purity:98%Color and Shape: white to off-white solidMolecular weight:170.59g/mol3-Chloro-2-methylbenzoic acid
CAS:Formula:C8H7ClO2Purity:97%Color and Shape:SolidMolecular weight:170.593-Chloro-2-methylbenzoic acid
CAS:<p>3-Chloro-2-methylbenzoic acid is a fine chemical, useful building block and versatile compound. It is a reagent for the production of other chemicals, such as pharmaceuticals and cosmetics. 3-Chloro-2-methylbenzoic acid is also used in research, where it can be used as a building block or scaffold for the synthesis of complex molecules. This chemical has many industrial applications, including use in manufacturing pesticides and herbicides.</p>Formula:C8H7ClO2Purity:Min. 95%Color and Shape:PowderMolecular weight:170.59 g/mol




