CAS 7499-66-3
:6-bromonaphthalen-2-amine
Description:
6-Bromonaphthalen-2-amine is an organic compound characterized by the presence of a bromine atom and an amino group attached to a naphthalene ring system. Specifically, the bromine is located at the 6-position, while the amino group is at the 2-position of the naphthalene structure. This compound typically appears as a solid and is known for its aromatic properties, which contribute to its stability and reactivity. It is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to undergo various chemical reactions, such as nucleophilic substitutions and coupling reactions. The presence of both the bromine and amino functional groups allows for further derivatization, making it a versatile intermediate in chemical synthesis. Additionally, 6-bromonaphthalen-2-amine may exhibit specific biological activities, which can be of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H8BrN
InChI:InChI=1/C10H8BrN/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1-6H,12H2
SMILES:c1cc(cc2ccc(cc12)N)Br
Synonyms:- 2-Naphthalenamine, 6-Bromo-
- 6-Bromnaphthalen-2-amin
- 6-Bromo-2-naphthalenamine
- 2-Amino-6-Bromonaphthalene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-6-bromonaphthalene
CAS:Formula:C10H8BrNPurity:96%Color and Shape:SolidMolecular weight:222.0812Ref: IN-DA00G2Y7
1g20.00€5g28.00€10g46.00€1kgTo inquire25g68.00€50g128.00€5kgTo inquire100g199.00€250g325.00€500g573.00€2-Amino-6-bromonaphthalene
CAS:2-Amino-6-bromonaphthaleneFormula:C10H8BrNPurity:96%Color and Shape: grey solidMolecular weight:222.08g/mol6-Bromo-naphthalen-2-ylamine
CAS:<p>6-Bromo-naphthalen-2-ylamine is a chromophore that has been used for the development of novel imaging techniques. This compound has been shown to have synaptic properties and can be used in the study of neurodegenerative diseases. It has also been shown to be an anticancer drug, with staining properties that are useful for the identification of motoneurons. 6-Bromo-naphthalen-2-ylamine is also useful as a fluorescent probe for studies of mechanisms of reaction yield and optical properties.</p>Formula:C10H8BrNPurity:Min. 98%Color and Shape:PowderMolecular weight:222.08 g/mol2-Amino-6-bromonaphthalene
CAS:Formula:C10H8BrNPurity:95%Color and Shape:SolidMolecular weight:222.0856-Bromo-2-naphthylamine
CAS:Controlled Product<p>Applications Used in the new synthesis of alkylsulphanylnaphthalenes and the synthesis and mesomorphic properties of novel naphthylisothiocyanates.<br>References Lauk, u., et al.: Helv. Chim. Acta, 68, 1406 (1985), Collina, S., et al.: Bioorg. Med. Chem., 8, 1925 (2000),<br></p>Formula:C10H8BrNColor and Shape:Light BeigeMolecular weight:222.08




