CAS 74990-43-5

5-amino-1-[2-nitro-4-(trifluoromethyl)phenyl]-1H-pyrazole-4-carbonitrile

Description:

5-amino-1-[2-nitro-4-(trifluoromethyl)phenyl]-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its complex structure, which includes a pyrazole ring, an amino group, a nitro group, and a trifluoromethyl group. The presence of the amino group suggests potential for hydrogen bonding and reactivity, while the nitro and trifluoromethyl groups contribute to its electronic properties and lipophilicity. This compound is likely to exhibit significant biological activity due to its structural features, making it of interest in pharmaceutical research. Its carbonitrile functional group enhances its reactivity, potentially allowing for further chemical modifications. The CAS number 74990-43-5 provides a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, the combination of functional groups in this compound suggests it may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₁₁H₆F₃N₅O₂

InChI: InChI=1/C11H6F3N5O2/c12-11(13,14)7-1-2-8(9(3-7)19(20)21)18-10(16)6(4-15)5-17-18/h1-3,5H,16H2

SMILES: c1cc(c(cc1C(F)(F)F)N(=O)=O)n1c(c(C#N)cn1)N

Synonyms:

• 1H-Pyrazole-4-carbonitrile, 5-amino-1-[2-nitro-4-(trifluoromethyl)phenyl]-
• 5-Amino-1-[2-nitro-4-(trifluoromethyl)phenyl]-1H-pyrazole-4-carbonitrile

5-Amino-1-(2-nitro-4-(trifluoromethyl)phenyl)-1H-pyrazole-4-carbonitrile

CAS: 74990-43-5

Formula: C₁₁H₆F₃N₅O₂

Color and Shape: Solid

Molecular weight: 297.1928

Ref: IN-DA005F01

5-Amino-1-[2-nitro-4-(trifluoromethyl)phenyl]-1H-pyrazole-4-carbonitrile

CAS: 74990-43-5

Formula: C₁₁H₆F₃N₅O₂

Color and Shape: Solid

Molecular weight: 297.197

Ref: 10-F046555