
CAS 749902-35-0
:Acetic acid, 1-[4-(chloromethyl)-2-thiazolyl]-2-[(4-methylphenyl)methylene]hydrazide
Description:
Acetic acid, 1-[4-(chloromethyl)-2-thiazolyl]-2-[(4-methylphenyl)methylene]hydrazide, identified by its CAS number 749902-35-0, is a chemical compound that features a complex structure incorporating both thiazole and hydrazide functionalities. This compound typically exhibits characteristics associated with hydrazides, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the chloromethyl group suggests potential for nucleophilic substitution reactions, while the thiazole ring may contribute to biological activity, as thiazoles are often found in pharmaceuticals. The methylphenyl moiety can enhance lipophilicity, affecting the compound's distribution in biological systems. Overall, this compound may possess interesting properties for applications in medicinal chemistry, particularly in the development of new therapeutic agents, due to its unique structural features that could interact with biological targets. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.
Formula:C14H14ClN3OS
InChI:InChI=1S/C14H14ClN3OS/c1-10-3-5-12(6-4-10)8-16-18(11(2)19)14-17-13(7-15)9-20-14/h3-6,8-9H,7H2,1-2H3
InChI key:InChIKey=KJVCNCNVFPNTPB-UHFFFAOYSA-N
SMILES:N(N=CC1=CC=C(C)C=C1)(C(C)=O)C2=NC(CCl)=CS2
Synonyms:- Acetic acid, [4-(chloromethyl)-2-thiazolyl][(4-methylphenyl)methylene]hydrazide
- Acetic acid, 1-[4-(chloromethyl)-2-thiazolyl]-2-[(4-methylphenyl)methylene]hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.