CAS 749902-86-1

2,4-Dimethyl 5-amino-3-(bromomethyl)-2,4-thiophenedicarboxylate

Description:

2,4-Dimethyl 5-amino-3-(bromomethyl)-2,4-thiophenedicarboxylate is a chemical compound characterized by its complex structure, which includes a thiophene ring and multiple functional groups. The presence of two carboxylate groups indicates its potential as a dicarboxylic acid derivative, while the dimethyl and amino substituents suggest it may exhibit basic properties and steric hindrance. The bromomethyl group introduces a halogen, which can enhance reactivity, particularly in nucleophilic substitution reactions. This compound may be of interest in organic synthesis and medicinal chemistry due to its potential biological activity and ability to serve as a building block for more complex molecules. Its solubility, stability, and reactivity would depend on the specific conditions, such as solvent and temperature. As with many organic compounds, safety precautions should be taken when handling it, considering potential toxicity or reactivity associated with its functional groups. Further studies would be necessary to fully elucidate its properties and applications in various fields.

Formula: C₉H₁₀BrNO₄S

InChI: InChI=1S/C9H10BrNO4S/c1-14-8(12)5-4(3-10)6(9(13)15-2)16-7(5)11/h3,11H2,1-2H3

InChI key: InChIKey=NMSHYUGFGVPXST-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C(CBr)=C(C(OC)=O)SC1N

Synonyms:

• 2,4-Thiophenedicarboxylic acid, 5-amino-3-(bromomethyl)-, 2,4-dimethyl ester
• 2,4-Dimethyl 5-amino-3-(bromomethyl)-2,4-thiophenedicarboxylate
• 2,4-Thiophenedicarboxylic acid, 5-amino-3-(bromomethyl)-, dimethyl ester