CAS 749906-84-1

2-[(4-Acetyl-2-fluorophenyl)thio]acetic acid

Description:

2-[(4-Acetyl-2-fluorophenyl)thio]acetic acid is a chemical compound characterized by its unique structure, which includes a thioether linkage and an acetic acid functional group. This compound features a fluorinated aromatic ring, which can influence its reactivity and biological activity. The presence of the acetyl group suggests potential for interactions in biological systems, possibly affecting its solubility and lipophilicity. The thioether moiety may enhance its stability and reactivity in various chemical reactions. Additionally, the fluorine atom can impart distinctive electronic properties, potentially affecting the compound's pharmacokinetics and pharmacodynamics if it is evaluated for medicinal applications. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of other solvents or reagents. Overall, this compound's unique structural features make it of interest in both synthetic chemistry and potential pharmaceutical development.

Formula: C₁₀H₉FO₃S

InChI: InChI=1S/C10H9FO3S/c1-6(12)7-2-3-9(8(11)4-7)15-5-10(13)14/h2-4H,5H2,1H3,(H,13,14)

InChI key: InChIKey=RUPLKAYIPMBIKZ-UHFFFAOYSA-N

SMILES: S(CC(O)=O)C1=C(F)C=C(C(C)=O)C=C1

Synonyms:

• 2-[(4-Acetyl-2-fluorophenyl)thio]acetic acid
• Acetic acid, [(4-acetyl-2-fluorophenyl)thio]-
• Acetic acid, 2-[(4-acetyl-2-fluorophenyl)thio]-