CAS 749906-94-3
:5-(Chloromethyl)-2-[4-(1-methylethyl)phenyl]thiazole
Description:
5-(Chloromethyl)-2-[4-(1-methylethyl)phenyl]thiazole, identified by its CAS number 749906-94-3, is a synthetic organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of a 4-(1-methylethyl)phenyl group indicates that it has a bulky substituent, contributing to its steric properties and possibly influencing its biological activity. Thiazoles are known for their diverse applications in pharmaceuticals, agrochemicals, and materials science due to their ability to interact with biological systems. The chloromethyl group can serve as a reactive site for nucleophilic substitution reactions, making this compound a valuable intermediate in organic synthesis. Overall, the unique structural features of this compound suggest potential utility in various chemical applications, although specific biological activities or applications would require further investigation.
Formula:C13H14ClNS
InChI:InChI=1S/C13H14ClNS/c1-9(2)10-3-5-11(6-4-10)13-15-8-12(7-14)16-13/h3-6,8-9H,7H2,1-2H3
InChI key:InChIKey=HGUIEYTXMGRBNL-UHFFFAOYSA-N
SMILES:C(Cl)C=1SC(=NC1)C2=CC=C(C(C)C)C=C2
Synonyms:- 5-(Chloromethyl)-2-[4-(1-methylethyl)phenyl]thiazole
- Thiazole, 5-(chloromethyl)-2-[4-(1-methylethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.