CAS 749907-04-8

Acetamide, 2-chloro-N-[1-(2,4-dichlorophenyl)ethyl]-

Description:

Acetamide, 2-chloro-N-[1-(2,4-dichlorophenyl)ethyl]- is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This substance features a chloro substituent at the 2-position and a phenyl group that is further substituted with two chlorine atoms at the 2 and 4 positions, contributing to its unique properties. The presence of the ethyl group linked to the nitrogen atom enhances its hydrophobic characteristics, while the chlorinated phenyl moiety may influence its biological activity and interaction with various receptors or enzymes. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals or agrochemicals, given their structural complexity and the presence of halogen atoms, which can affect reactivity and stability. Additionally, the compound's solubility, melting point, and boiling point would be influenced by its molecular structure, making it relevant for various chemical and biological assessments. Safety and handling precautions are essential when working with such compounds, as they may exhibit toxicity or environmental hazards.

Formula: C₁₀H₁₀Cl₃NO

InChI: InChI=1S/C10H10Cl3NO/c1-6(14-10(15)5-11)8-3-2-7(12)4-9(8)13/h2-4,6H,5H2,1H3,(H,14,15)

InChI key: InChIKey=CPEIIDYZXPPDDE-UHFFFAOYSA-N

SMILES: C(NC(CCl)=O)(C)C1=C(Cl)C=C(Cl)C=C1

Synonyms:

• Acetamide, 2-chloro-N-[1-(2,4-dichlorophenyl)ethyl]-
• 2-Chloro-N-[1-(2,4-dichlorophenyl)ethyl]acetamide