CymitQuimica logo

CAS 749920-14-7

:

2-Chloro-1-[2,5-dimethyl-1-[4-(1-methylethyl)phenyl]-1H-pyrrol-3-yl]ethanone

Description:
2-Chloro-1-[2,5-dimethyl-1-[4-(1-methylethyl)phenyl]-1H-pyrrol-3-yl]ethanone, with the CAS number 749920-14-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a chloro group, a ketone functional group, and a pyrrole ring. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and organic synthesis. Its structure suggests potential biological activity, possibly as a pharmaceutical agent or a precursor in the synthesis of more complex molecules. The presence of the chloro substituent may influence its reactivity and solubility, while the dimethyl and isopropyl groups contribute to its steric properties. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with exposure. Overall, this compound exemplifies the intricate nature of organic chemistry, where variations in structure can lead to significant differences in chemical behavior and application.
Formula:C17H20ClNO
InChI:InChI=1S/C17H20ClNO/c1-11(2)14-5-7-15(8-6-14)19-12(3)9-16(13(19)4)17(20)10-18/h5-9,11H,10H2,1-4H3
InChI key:InChIKey=UIEAVSMWTIFBQX-UHFFFAOYSA-N
SMILES:CC=1N(C(C)=CC1C(CCl)=O)C2=CC=C(C(C)C)C=C2
Synonyms:
  • 2-Chloro-1-[2,5-dimethyl-1-[4-(1-methylethyl)phenyl]-1H-pyrrol-3-yl]ethanone
  • Ethanone, 2-chloro-1-[2,5-dimethyl-1-[4-(1-methylethyl)phenyl]-1H-pyrrol-3-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.