
CAS 749920-15-8
:2-Chloro-1-[1-(3,5-dimethylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]ethanone
Description:
2-Chloro-1-[1-(3,5-dimethylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]ethanone is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a ketone functional group, and a pyrrole ring substituted with a dimethylphenyl moiety. This compound typically exhibits properties common to halogenated ketones, such as moderate to high reactivity due to the presence of the electrophilic carbonyl group and the electron-withdrawing chlorine atom. It may display significant lipophilicity, influencing its solubility in organic solvents while being less soluble in water. The presence of the pyrrole ring suggests potential biological activity, as pyrrole derivatives are often explored for their pharmacological properties. Additionally, the compound's structural features may contribute to its stability under certain conditions, although specific stability data would depend on environmental factors. Overall, this compound's unique structure positions it as a candidate for further research in medicinal chemistry and material science applications.
Formula:C16H18ClNO
InChI:InChI=1S/C16H18ClNO/c1-10-5-11(2)7-14(6-10)18-12(3)8-15(13(18)4)16(19)9-17/h5-8H,9H2,1-4H3
InChI key:InChIKey=TXBANKQTNXOZPT-UHFFFAOYSA-N
SMILES:CC=1N(C2=CC(C)=CC(C)=C2)C(C)=CC1C(CCl)=O
Synonyms:- Ethanone, 2-chloro-1-[1-(3,5-dimethylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-
- 2-Chloro-1-[1-(3,5-dimethylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.