CAS 749920-20-5
:3-Chloro-4-ethoxy-5-methoxybenzaldehyde oxime
Description:
3-Chloro-4-ethoxy-5-methoxybenzaldehyde oxime is an organic compound characterized by its functional groups, including a benzaldehyde moiety, an oxime group, and various substituents on the aromatic ring. The presence of the chloro, ethoxy, and methoxy groups contributes to its unique chemical properties, such as polarity and reactivity. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic aromatic structure, while the oxime functional group can participate in hydrogen bonding, influencing its solubility in polar solvents. The oxime group also suggests potential reactivity, particularly in condensation reactions or as a precursor to other functional transformations. Additionally, the compound may display interesting biological activities, making it of interest in medicinal chemistry and synthetic applications. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, 3-Chloro-4-ethoxy-5-methoxybenzaldehyde oxime represents a versatile structure in organic synthesis and research.
Formula:C10H12ClNO3
InChI:InChI=1S/C10H12ClNO3/c1-3-15-10-8(11)4-7(6-12-13)5-9(10)14-2/h4-6,13H,3H2,1-2H3
InChI key:InChIKey=DXECFQXJPSKTDU-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OC)C=C(C=NO)C=C1Cl
Synonyms:- 3-Chloro-4-ethoxy-5-methoxybenzaldehyde oxime
- Benzaldehyde, 3-chloro-4-ethoxy-5-methoxy-, oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.