
CAS 749920-72-7
:2-Chloro-N-(2-cyano-3-benzofuranyl)acetamide
Description:
2-Chloro-N-(2-cyano-3-benzofuranyl)acetamide is a chemical compound characterized by its unique structural features, which include a chloro group, a cyano group, and a benzofuran moiety. The presence of the chloro substituent indicates potential reactivity, particularly in nucleophilic substitution reactions. The cyano group contributes to the compound's polarity and can influence its solubility in various solvents. The benzofuran ring system adds to the compound's aromatic character, which may enhance its stability and influence its electronic properties. This compound may exhibit biological activity due to its structural components, making it of interest in medicinal chemistry and drug development. Its molecular interactions can be studied through various analytical techniques, including spectroscopy and chromatography. Additionally, the compound's CAS number, 749920-72-7, allows for easy identification in chemical databases and literature. Overall, 2-Chloro-N-(2-cyano-3-benzofuranyl)acetamide presents a combination of functional groups that may lead to diverse applications in research and industry.
Formula:C11H7ClN2O2
InChI:InChI=1S/C11H7ClN2O2/c12-5-10(15)14-11-7-3-1-2-4-8(7)16-9(11)6-13/h1-4H,5H2,(H,14,15)
InChI key:InChIKey=WABHXSZCVUSUFX-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C=1C=2C(OC1C#N)=CC=CC2
Synonyms:- 2-Chloro-N-(2-cyano-3-benzofuranyl)acetamide
- Acetamide, 2-chloro-N-(2-cyano-3-benzofuranyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.