CAS 749932-17-0

4-bromo-1-(difluoromethyl)-2-fluorobenzene

Description:

4-Bromo-1-(difluoromethyl)-2-fluorobenzene is an aromatic compound characterized by the presence of a bromine atom, a difluoromethyl group, and a fluorine atom attached to a benzene ring. This compound features a bromine substituent at the para position relative to the difluoromethyl group and a fluorine substituent at the ortho position. The presence of multiple halogen atoms contributes to its unique chemical properties, including increased reactivity and potential applications in various fields such as pharmaceuticals and agrochemicals. The difluoromethyl group enhances the compound's lipophilicity and may influence its biological activity. Additionally, the compound's structure suggests potential for participation in electrophilic aromatic substitution reactions, as well as its utility in synthetic organic chemistry. Its CAS number, 749932-17-0, allows for precise identification in chemical databases and literature. Overall, 4-bromo-1-(difluoromethyl)-2-fluorobenzene is a notable compound due to its halogenated structure, which can lead to interesting chemical behavior and applications.

Formula: C₇H₄BrF₃

InChI: InChI=1/C7H4BrF3/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,7H

SMILES: c1cc(c(cc1Br)F)C(F)F

Synonyms:

• Benzene, 4-bromo-1-(difluoromethyl)-2-fluoro-
• 4-Bromo-1-(difluoromethyl)-2-fluorobenzene
• 4-Bromo-1-difluoromethyl-2-fluorobenzene

4-BROMO-1-DIFLUOROMETHYL-2-FLUOROBENZENE

CAS: 749932-17-0

Formula: C₇H₄BrF₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 225.0059

Ref: IN-DA003KUM

4-Bromo-2-fluorobenzal fluoride

CAS: 749932-17-0

4-Bromo-2-fluorobenzal fluoride

Purity: 98%

Molecular weight: 225.01g/mol

Ref: 54-PC49172

4-Bromo-1-difluoromethyl-2-fluorobenzene

CAS: 749932-17-0

Formula: C₇H₄BrF₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 225.008

Ref: 10-F023879