CAS 749932-89-6

4-Bromo-2-chlorobenzeneacetaldehyde

Description:

4-Bromo-2-chlorobenzeneacetaldehyde is an organic compound characterized by the presence of both bromine and chlorine substituents on a benzene ring, along with an aldehyde functional group. This compound features a benzene ring substituted at the 4-position with a bromine atom and at the 2-position with a chlorine atom, while the acetaldehyde group is attached to the benzene at the 1-position. The presence of these halogen atoms can influence the compound's reactivity, polarity, and overall chemical behavior, making it useful in various synthetic applications. The aldehyde functional group is known for its reactivity, particularly in nucleophilic addition reactions. Additionally, the compound may exhibit distinct physical properties such as boiling and melting points, which are influenced by the halogen substituents and the overall molecular structure. Due to its specific functional groups, 4-Bromo-2-chlorobenzeneacetaldehyde may also serve as an intermediate in the synthesis of more complex organic molecules in pharmaceutical or agrochemical research.

Formula: C₈H₆BrClO

InChI: InChI=1S/C8H6BrClO/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,4-5H,3H2

InChI key: InChIKey=DSUMNUVLXJESFO-UHFFFAOYSA-N

SMILES: C(C=O)C1=C(Cl)C=C(Br)C=C1

Synonyms:

• 2-(4-Bromo-2-chlorophenyl)acetaldehyde
• Benzeneacetaldehyde, 4-bromo-2-chloro-
• 4-Bromo-2-chlorobenzeneacetaldehyde
• 2-(4-Bromo-2-chlorophenyl)ethanone