
CAS 75-39-8
:Ethanol, 1-amino-
Description:
Ethanol, 1-amino-, also known as 2-aminoethanol or ethanolamine, is an organic compound characterized by the presence of both an amino group (-NH2) and a hydroxyl group (-OH) attached to a two-carbon ethyl chain. This colorless, viscous liquid has a slightly fishy odor and is hygroscopic, meaning it readily absorbs moisture from the air. Ethanolamine is soluble in water and polar organic solvents due to its ability to form hydrogen bonds. It is commonly used in various applications, including as a surfactant, emulsifier, and in the production of pharmaceuticals and personal care products. Additionally, it serves as a building block in the synthesis of other chemicals, such as herbicides and corrosion inhibitors. Ethanolamine can act as a weak base, reacting with acids to form salts, and it is also involved in biological processes, such as the synthesis of phospholipids in cell membranes. Safety precautions are necessary when handling this compound, as it can be irritating to the skin and eyes.
Formula:C2H7NO
InChI:InChI=1S/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3
InChI key:InChIKey=UJPKMTDFFUTLGM-UHFFFAOYSA-N
SMILES:C(C)(N)O
Synonyms:- α-Aminoethyl alcohol
- Aldehyde ammonia
- 1-Aminoethanol
- Acetaldehyde ammonia
- Ethanol, 1-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ref: 4Z-H-086001
Discontinued product
