CAS 75-96-7
:Tribromoacetic acid
Description:
Tribromoacetic acid is a halogenated organic compound characterized by the presence of three bromine atoms attached to an acetic acid backbone. Its chemical formula is C2HBr3O2, and it is known for its strong acidity, which is typical of carboxylic acids. The presence of multiple bromine atoms significantly enhances its reactivity and alters its physical properties compared to non-halogenated acetic acid. Tribromoacetic acid is typically a colorless to pale yellow liquid with a pungent odor. It is soluble in water and organic solvents, making it versatile in various chemical applications. This compound is primarily used in organic synthesis, particularly in the production of brominated derivatives and as a reagent in biochemical research. Due to its halogen content, it may pose environmental and health risks, necessitating careful handling and disposal. As with many halogenated compounds, tribromoacetic acid can be a subject of regulatory scrutiny due to potential toxicity and environmental impact.
Formula:C2HBr3O2
InChI:InChI=1S/C2HBr3O2/c3-2(4,5)1(6)7/h(H,6,7)
InChI key:InChIKey=QIONYIKHPASLHO-UHFFFAOYSA-N
SMILES:C(C(O)=O)(Br)(Br)Br
Synonyms:- 2,2,2-Tribromoacetic acid
- Acetic acid, 2,2,2-tribromo-
- Acetic acid, tribromo-
- NSC 171102
- Tribromacetic acid
- Tribromoacetate
- Tribromoacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Tribromoacetic Acid
CAS:Formula:C2HBr3O2Purity:>98.0%(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:296.74EPA Method 552 Halogenated Acetic Mixture 1000 ug/mL in Methyl tert-butyl ether
CAS:Controlled ProductColor and Shape:MixtureTribromoacetic acid
CAS:Controlled ProductFormula:C2HBr3O2Color and Shape:NeatMolecular weight:296.74Haloacetic acid mixture for HJ 758-2015 various concentrations in Methyl tert-butyl ether
CAS:Controlled ProductColor and Shape:MixtureEPA Method 552 Halogenated Acetic Mixture 100 µg/mL in Methyl tert-butyl ether
CAS:Formula:C2H3BrO2Color and Shape:MixtureMolecular weight:138.95EPA Method 552.3 UCMR 4 200-2000 ug/mL in Methyl tert-butyl ether
CAS:Formula:C2H3BrO2Color and Shape:MixtureMolecular weight:138.952,2,2-Tribromoacetic acid
CAS:Formula:C2HBr3O2Purity:95.0%Color and Shape:SolidMolecular weight:296.74EPA Method 552 Halogenated Acetic Mixture 80-800 µg/mL in Methyl tert-butyl ether
CAS:Formula:C2H3BrO2Color and Shape:MixtureMolecular weight:138.95



