CymitQuimica logo

CAS 750-88-9

:

Cinchonan-9-ol, 6′-methoxy-, (8α,9R)-, monobenzoate (salt)

Description:
Cinchonan-9-ol, 6′-methoxy-, (8α,9R)-, monobenzoate (salt) is a chemical compound derived from cinchona alkaloids, which are known for their medicinal properties, particularly in treating malaria. This compound features a complex structure characterized by a cinchona backbone with a methoxy group at the 6′ position and a benzoate moiety, which contributes to its solubility and potential bioactivity. The (8α,9R) stereochemistry indicates specific spatial arrangements of atoms, which can significantly influence the compound's pharmacological effects. As a salt, it may exhibit enhanced stability and solubility compared to its free base form. The compound is likely to have applications in pharmaceuticals, particularly in the development of antimalarial agents or other therapeutic uses. Its properties, such as melting point, solubility, and reactivity, would be influenced by the presence of the benzoate group and the overall molecular structure. Further studies would be necessary to fully elucidate its biological activity and potential applications in medicine.
Formula:C20H24N2O2·C7H6O2
InChI:InChI=1S/C20H24N2O2.C7H6O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;8-7(9)6-4-2-1-3-5-6/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;1-5H,(H,8,9)/t13-,14-,19-,20+;/m0./s1
InChI key:InChIKey=AQHKBFWCAHXPDT-DSXUQNDKSA-N
SMILES:[C@@H](O)(C=1C2=C(C=CC(OC)=C2)N=CC1)[C@]3([N@@]4C[C@H](C=C)[C@](C3)(CC4)[H])[H].C(O)(=O)C1=CC=CC=C1
Synonyms:
  • (8alpha,9R)-6'-methoxycinchonan-9-ol benzoate (1:1)
  • Cinchonan-9-ol, 6′-methoxy-, (8α,9R)-, monobenzoate (salt)
  • Quinine, monobenzoate (salt)
  • Quinine benzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.