CAS 7500-05-2
:Pyridinium, 3-hydroxy-1-methyl-, iodide (1:1)
Description:
Pyridinium, 3-hydroxy-1-methyl-, iodide (1:1), commonly referred to as methyl-3-hydroxypyridinium iodide, is a quaternary ammonium salt characterized by its pyridine ring structure with a hydroxyl group and a methyl group attached to the nitrogen atom. This compound typically appears as a white to off-white crystalline solid and is soluble in water and polar organic solvents due to its ionic nature. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, which can influence its reactivity and interactions with other molecules. Pyridinium iodide salts are often used in organic synthesis, as they can act as intermediates or catalysts in various chemical reactions. Additionally, the iodide ion can serve as a leaving group in nucleophilic substitution reactions. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper laboratory practices should be followed when working with this compound.
Formula:C6H8NO·I
InChI:InChI=1S/C6H7NO.HI/c1-7-4-2-3-6(8)5-7;/h2-5H,1H3;1H
InChI key:InChIKey=PTNGQQDWNQHRAZ-UHFFFAOYSA-N
SMILES:OC1=C[N+](C)=CC=C1.[I-]
Synonyms:- 1-Methyl-3-hydroxypyridinium iodide
- 3-Hydroxy-1-methylpyridin-1-ium iodide
- 3-Hydroxy-1-methylpyridinium iodide
- 3-Hydroxypyridinium methiodide
- N-Methyl-3-hydroxypyridinium iodide
- Pyridinium, 3-Hydroxy-1-Methyl-
- Pyridinium, 3-hydroxy-1-methyl-, iodide
- Pyridinium, 3-hydroxy-1-methyl-, iodide (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Hydroxy-1-methyl-pyridinium Iodide
CAS:Controlled ProductFormula:C6H8NO·IColor and Shape:NeatMolecular weight:237.043-Hydroxy-1-methylpyridinium Iodide
CAS:Controlled ProductFormula:C6H8NO·IColor and Shape:NeatMolecular weight:237.043-Hydroxy-1-methylpyridinium iodide
CAS:<p>3-Hydroxy-1-methylpyridinium iodide is a solute that has a molecular weight of 183.12 and the chemical formula CHNO. It is synthesized by the reaction of hydrogen peroxide with pyridinium dichromate in the presence of vitamin B6. 3-Hydroxy-1-methylpyridinium iodide has been shown to be an effective probe for 13C NMR spectroscopy and can be used as a boronic ester with an electron withdrawing group. The synthesis of 3-hydroxy-1-methylpyridinium iodide may also include halides such as bromo or chloro compounds, which are added to increase the solubility of the product.</p>Formula:C6H8NOPurity:Min. 95%Molecular weight:110.13 g/mol


