CAS 7500-66-5
:(1-bromocyclohexyl)(phenyl)methanone
Description:
(1-bromocyclohexyl)(phenyl)methanone, with the CAS number 7500-66-5, is an organic compound characterized by the presence of a cyclohexyl group, a bromine atom, and a phenyl group attached to a carbonyl functional group. This compound features a ketone functional group, which is indicated by the presence of the methanone moiety. The bromine atom introduces notable reactivity, making it a potential electrophile in various chemical reactions. The cyclohexyl ring contributes to the compound's hydrophobic characteristics, while the phenyl group enhances its stability and can influence its electronic properties. The compound is likely to be a solid at room temperature, exhibiting moderate solubility in organic solvents. Its reactivity may allow it to participate in nucleophilic substitution reactions, particularly due to the presence of the bromine atom. Overall, (1-bromocyclohexyl)(phenyl)methanone serves as a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C13H15BrO
InChI:InChI=1/C13H15BrO/c14-13(9-5-2-6-10-13)12(15)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2
SMILES:c1ccc(cc1)C(=O)C1(CCCCC1)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1-Bromocyclohexyl)phenylmethanone
CAS:Controlled ProductFormula:C13H15BrOColor and Shape:NeatMolecular weight:267.162
